C23H33N5O4 — CID 111301879
N-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111301879) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111301879 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCCO2)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C23H33N5O4/c1-24-23(28-11-9-27(10-12-28)22(30)20-8-4-14-32-20)25-16-17-5-2-6-18(15-17)26-21(29)19-7-3-13-31-19/h2,5-6,15,19-20H,3-4,7-14,16H2,1H3,(H,24,25)(H,26,29) |
| InChIKey | GWUTYMNPFOOZNK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|