C23H34N4O2 — CID 111745104
N-[3-[[[C-(2-azaspiro[4.5]decan-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111745104) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[3-[[[C-(2-azaspiro[4.5]decan-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[C-(2-azaspiro[4.5]decan-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111745104 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[3-[[[C-(2-azaspiro[4.5]decan-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCCO2)c1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C23H34N4O2/c1-24-22(27-13-12-23(17-27)10-3-2-4-11-23)25-16-18-7-5-8-19(15-18)26-21(28)20-9-6-14-29-20/h5,7-8,15,20H,2-4,6,9-14,16-17H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | CEBIXLFQLUHTIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|