C22H33IN4O4 — CID 110993322
ethyl 1-[N'-methyl-N-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993322) has the molecular formula C22H33IN4O4 and a molecular weight of 544.43 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993322 |
| Molecular Formula | C22H33IN4O4 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCc2cccc(NC(=O)C3CCCO3)c2)C1.I |
| InChI | InChI=1S/C22H32N4O4.HI/c1-3-29-21(28)17-8-5-11-26(15-17)22(23-2)24-14-16-7-4-9-18(13-16)25-20(27)19-10-6-12-30-19;/h4,7,9,13,17,19H,3,5-6,8,10-12,14-15H2,1-2H3,(H,23,24)(H,25,27);1H |
| InChIKey | ZJMFZQHRBPSGJB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|