C23H35N5O3 — CID 111162838
ethyl 4-[N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111162838) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is ethyl 4-[N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111162838 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | ethyl 4-[N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2cccc(NC(=O)C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H35N5O3/c1-3-31-23(30)28-14-12-27(13-15-28)22(24-2)25-17-18-8-7-11-20(16-18)26-21(29)19-9-5-4-6-10-19/h7-8,11,16,19H,3-6,9-10,12-15,17H2,1-2H3,(H,24,25)(H,26,29) |
| InChIKey | NMBSMVICYVSRGM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|