C22H33N5O3 — CID 111157145
ethyl 1-[N'-methyl-N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111157145) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111157145 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2cccc(NC(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C22H33N5O3/c1-3-30-20(28)18-9-13-26(14-10-18)21(23-2)24-16-17-7-6-8-19(15-17)25-22(29)27-11-4-5-12-27/h6-8,15,18H,3-5,9-14,16H2,1-2H3,(H,23,24)(H,25,29) |
| InChIKey | HVKUWESBEZZXLB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|