C21H31N5O3 — CID 111301601
2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]-N-(2-phenylethyl)acetamide (PubChem CID 111301601) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 111301601 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]-N-(2-phenylethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)NCCc1ccccc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H31N5O3/c1-22-21(24-16-19(27)23-10-9-17-6-3-2-4-7-17)26-13-11-25(12-14-26)20(28)18-8-5-15-29-18/h2-4,6-7,18H,5,8-16H2,1H3,(H,22,24)(H,23,27) |
| InChIKey | MUJITQARLOELJH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|