C19H30N4O2S2 — CID 8788628
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (PubChem CID 8788628) has the molecular formula C19H30N4O2S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8788628 |
| Molecular Formula | C19H30N4O2S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=S)N[C@H]2CCCC[C@H]2C)cc1OC |
| InChI | InChI=1S/C19H30N4O2S2/c1-13-6-4-5-7-15(13)21-19(27)23-22-18(26)20-11-10-14-8-9-16(24-2)17(12-14)25-3/h8-9,12-13,15H,4-7,10-11H2,1-3H3,(H2,20,22,26)(H2,21,23,27)/t13-,15+/m1/s1 |
| InChIKey | LDBRZEWAFZKTAQ-HIFRSBDPSA-N |
| XLogP | 2.67 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|