C20H26N4O2S2 — CID 8683712
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3,5-dimethylphenyl)carbamothioylamino]thiourea (PubChem CID 8683712) has the molecular formula C20H26N4O2S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3,5-dimethylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3,5-dimethylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8683712 |
| Molecular Formula | C20H26N4O2S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3,5-dimethylphenyl)carbamothioylamino]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=S)Nc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C20H26N4O2S2/c1-13-9-14(2)11-16(10-13)22-20(28)24-23-19(27)21-8-7-15-5-6-17(25-3)18(12-15)26-4/h5-6,9-12H,7-8H2,1-4H3,(H2,21,23,27)(H2,22,24,28) |
| InChIKey | NIDKHRIJENGXBG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|