C19H22F2N2O2S — CID 8600105
1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 8600105) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8600105 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | COc1cc(CCNC(=S)Nc2cc(C)cc(C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H22F2N2O2S/c1-12-8-13(2)10-15(9-12)23-19(26)22-7-6-14-4-5-16(25-18(20)21)17(11-14)24-3/h4-5,8-11,18H,6-7H2,1-3H3,(H2,22,23,26) |
| InChIKey | HAHAYSLKONOZTB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|