C16H17F2N3O3 — CID 24528610
1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-pyridin-3-ylurea (PubChem CID 24528610) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 24528610 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-3-pyridin-3-ylurea |
| SMILES | COc1cc(CCNC(=O)Nc2cccnc2)ccc1OC(F)F |
| InChI | InChI=1S/C16H17F2N3O3/c1-23-14-9-11(4-5-13(14)24-15(17)18)6-8-20-16(22)21-12-3-2-7-19-10-12/h2-5,7,9-10,15H,6,8H2,1H3,(H2,20,21,22) |
| InChIKey | FXGIGRBKWGOUSQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |