C19H26IN5O3 — CID 111214680
2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111214680) has the molecular formula C19H26IN5O3 and a molecular weight of 499.35 g/mol. Its IUPAC name is 2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111214680 |
| Molecular Formula | C19H26IN5O3 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCC(=O)Nc1cccnc1.I |
| InChI | InChI=1S/C19H25N5O3.HI/c1-20-19(23-13-18(25)24-15-5-4-9-21-12-15)22-10-8-14-6-7-16(26-2)17(11-14)27-3;/h4-7,9,11-12H,8,10,13H2,1-3H3,(H,24,25)(H2,20,22,23);1H |
| InChIKey | ZLBBXVCNSAFYOA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|