C18H19ClF2N2O3S — CID 2207233
1-[3-chloro-4-(difluoromethoxy)phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 2207233) has the molecular formula C18H19ClF2N2O3S and a molecular weight of 416.88 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2207233 |
| Molecular Formula | C18H19ClF2N2O3S |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ccc(OC(F)F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H19ClF2N2O3S/c1-24-15-5-3-11(9-16(15)25-2)7-8-22-18(27)23-12-4-6-14(13(19)10-12)26-17(20)21/h3-6,9-10,17H,7-8H2,1-2H3,(H2,22,23,27) |
| InChIKey | KBDKXYJYUXITGL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|