C11H14BrF2NO4S — CID 83085287
1-bromo-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]methanesulfonamide (PubChem CID 83085287) has the molecular formula C11H14BrF2NO4S and a molecular weight of 374.20 g/mol. Its IUPAC name is 1-bromo-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 83085287 |
| Molecular Formula | C11H14BrF2NO4S |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 1-bromo-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]methanesulfonamide |
| SMILES | COc1cc(CCNS(=O)(=O)CBr)ccc1OC(F)F |
| InChI | InChI=1S/C11H14BrF2NO4S/c1-18-10-6-8(2-3-9(10)19-11(13)14)4-5-15-20(16,17)7-12/h2-3,6,11,15H,4-5,7H2,1H3 |
| InChIKey | GDTFECKWPCFKBO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|