C18H19F2NO5S — CID 8817900
4-acetyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]benzenesulfonamide (PubChem CID 8817900) has the molecular formula C18H19F2NO5S and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-acetyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8817900 |
| Molecular Formula | C18H19F2NO5S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 4-acetyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]benzenesulfonamide |
| SMILES | COc1cc(CCNS(=O)(=O)c2ccc(C(C)=O)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H19F2NO5S/c1-12(22)14-4-6-15(7-5-14)27(23,24)21-10-9-13-3-8-16(26-18(19)20)17(11-13)25-2/h3-8,11,18,21H,9-10H2,1-2H3 |
| InChIKey | MFHGVCJOSZSFKF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |