C17H21N3O2S — CID 19685990
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 19685990) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19685990 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ncccc2C)cc1OC |
| InChI | InChI=1S/C17H21N3O2S/c1-12-5-4-9-18-16(12)20-17(23)19-10-8-13-6-7-14(21-2)15(11-13)22-3/h4-7,9,11H,8,10H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | UEULTYJZICJJOM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|