C15H14Cl3N3S — CID 19704195
1-(3-methyl-2-pyridinyl)-3-[2-(2,3,5-trichlorophenyl)ethyl]thiourea (PubChem CID 19704195) has the molecular formula C15H14Cl3N3S and a molecular weight of 374.72 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-[2-(2,3,5-trichlorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-[2-(2,3,5-trichlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19704195 |
| Molecular Formula | C15H14Cl3N3S |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-[2-(2,3,5-trichlorophenyl)ethyl]thiourea |
| SMILES | Cc1cccnc1NC(=S)NCCc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C15H14Cl3N3S/c1-9-3-2-5-19-14(9)21-15(22)20-6-4-10-7-11(16)8-12(17)13(10)18/h2-3,5,7-8H,4,6H2,1H3,(H2,19,20,21,22) |
| InChIKey | MDQFSOSOVQWPAQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|