C14H11ClF3N3S — CID 22923258
1-(3-chloro-2-pyridinyl)-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea (PubChem CID 22923258) has the molecular formula C14H11ClF3N3S and a molecular weight of 345.78 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-2-pyridinyl)-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 22923258 |
| Molecular Formula | C14H11ClF3N3S |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea |
| SMILES | Fc1ccc(CCNC(=S)Nc2ncccc2Cl)c(F)c1F |
| InChI | InChI=1S/C14H11ClF3N3S/c15-9-2-1-6-19-13(9)21-14(22)20-7-5-8-3-4-10(16)12(18)11(8)17/h1-4,6H,5,7H2,(H2,19,20,21,22) |
| InChIKey | NNVIQVZHEWAQKO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|