C14H12F3N3S — CID 19703878
1-pyridin-2-yl-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea (PubChem CID 19703878) has the molecular formula C14H12F3N3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-pyridin-2-yl-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea.
| Compound Name | 1-pyridin-2-yl-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19703878 |
| Molecular Formula | C14H12F3N3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-pyridin-2-yl-3-[2-(2,3,4-trifluorophenyl)ethyl]thiourea |
| SMILES | Fc1ccc(CCNC(=S)Nc2ccccn2)c(F)c1F |
| InChI | InChI=1S/C14H12F3N3S/c15-10-5-4-9(12(16)13(10)17)6-8-19-14(21)20-11-3-1-2-7-18-11/h1-5,7H,6,8H2,(H2,18,19,20,21) |
| InChIKey | ZWEBXBFTKQJICP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|