C13H12BrFN4S — CID 19704036
1-(3-bromo-2-pyridinyl)-3-[2-(3-fluoro-2-pyridinyl)ethyl]thiourea (PubChem CID 19704036) has the molecular formula C13H12BrFN4S and a molecular weight of 355.24 g/mol. Its IUPAC name is 1-(3-bromo-2-pyridinyl)-3-[2-(3-fluoro-2-pyridinyl)ethyl]thiourea.
| Compound Name | 1-(3-bromo-2-pyridinyl)-3-[2-(3-fluoro-2-pyridinyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19704036 |
| Molecular Formula | C13H12BrFN4S |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 1-(3-bromo-2-pyridinyl)-3-[2-(3-fluoro-2-pyridinyl)ethyl]thiourea |
| SMILES | Fc1cccnc1CCNC(=S)Nc1ncccc1Br |
| InChI | InChI=1S/C13H12BrFN4S/c14-9-3-1-7-17-12(9)19-13(20)18-8-5-11-10(15)4-2-6-16-11/h1-4,6-7H,5,8H2,(H2,17,18,19,20) |
| InChIKey | XUABLVSQTHYXCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|