C15H12Cl2F3N3S — CID 19703483
1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea (PubChem CID 19703483) has the molecular formula C15H12Cl2F3N3S and a molecular weight of 394.25 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea.
| Compound Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 19703483 |
| Molecular Formula | C15H12Cl2F3N3S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea |
| SMILES | FC(F)(F)c1cccnc1NC(=S)NCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N3S/c16-11-4-1-5-12(17)9(11)6-8-22-14(24)23-13-10(15(18,19)20)3-2-7-21-13/h1-5,7H,6,8H2,(H2,21,22,23,24) |
| InChIKey | XYVAGWCVFSTTOV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|