C13H11Cl3N4S — CID 19704024
1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea (PubChem CID 19704024) has the molecular formula C13H11Cl3N4S and a molecular weight of 361.69 g/mol. Its IUPAC name is 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19704024 |
| Molecular Formula | C13H11Cl3N4S |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea |
| SMILES | S=C(NCCc1c(Cl)cccc1Cl)Nc1nccnc1Cl |
| InChI | InChI=1S/C13H11Cl3N4S/c14-9-2-1-3-10(15)8(9)4-5-19-13(21)20-12-11(16)17-6-7-18-12/h1-3,6-7H,4-5H2,(H2,18,19,20,21) |
| InChIKey | WIYPXGBAJYMLKH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|