C14H13Cl3N4S — CID 139623226
1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)propyl]thiourea (PubChem CID 139623226) has the molecular formula C14H13Cl3N4S and a molecular weight of 375.71 g/mol. Its IUPAC name is 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)propyl]thiourea.
| Compound Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 139623226 |
| Molecular Formula | C14H13Cl3N4S |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2,6-dichlorophenyl)propyl]thiourea |
| SMILES | CC(CNC(=S)Nc1nccnc1Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H13Cl3N4S/c1-8(11-9(15)3-2-4-10(11)16)7-20-14(22)21-13-12(17)18-5-6-19-13/h2-6,8H,7H2,1H3,(H2,19,20,21,22) |
| InChIKey | QUILDOSLUYCGCM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|