C14H15ClN4S — CID 19703624
1-(3-chloropyrazin-2-yl)-3-[2-(2-methylphenyl)ethyl]thiourea (PubChem CID 19703624) has the molecular formula C14H15ClN4S and a molecular weight of 306.82 g/mol. Its IUPAC name is 1-(3-chloropyrazin-2-yl)-3-[2-(2-methylphenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2-methylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19703624 |
| Molecular Formula | C14H15ClN4S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(3-chloropyrazin-2-yl)-3-[2-(2-methylphenyl)ethyl]thiourea |
| SMILES | Cc1ccccc1CCNC(=S)Nc1nccnc1Cl |
| InChI | InChI=1S/C14H15ClN4S/c1-10-4-2-3-5-11(10)6-7-18-14(20)19-13-12(15)16-8-9-17-13/h2-5,8-9H,6-7H2,1H3,(H2,17,18,19,20) |
| InChIKey | NAVAAWRBVFBXER-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|