C11H17N3S — CID 19685982
1-butyl-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 19685982) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-butyl-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-butyl-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19685982 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-butyl-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | CCCCNC(=S)Nc1ncccc1C |
| InChI | InChI=1S/C11H17N3S/c1-3-4-7-13-11(15)14-10-9(2)6-5-8-12-10/h5-6,8H,3-4,7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | MYTPVANNWTWTPG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|