C11H15N3O2 — CID 44997048
N'-(3-methyl-2-pyridinyl)-N-propyloxamide (PubChem CID 44997048) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N'-(3-methyl-2-pyridinyl)-N-propyloxamide.
| Compound Name | N'-(3-methyl-2-pyridinyl)-N-propyloxamide |
|---|---|
| PubChem CID | 44997048 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N'-(3-methyl-2-pyridinyl)-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)Nc1ncccc1C |
| InChI | InChI=1S/C11H15N3O2/c1-3-6-13-10(15)11(16)14-9-8(2)5-4-7-12-9/h4-5,7H,3,6H2,1-2H3,(H,13,15)(H,12,14,16) |
| InChIKey | SKUWYNDEQYVMLL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|