C10H10N6O2 — CID 108519230
N-(3-methyl-2-pyridinyl)-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519230) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519230 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | Cc1cccnc1NC(=O)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C10H10N6O2/c1-7-3-2-4-11-8(7)14-9(17)10(18)15-16-5-12-13-6-16/h2-6H,1H3,(H,15,18)(H,11,14,17) |
| InChIKey | JHCCODUQXXWZRX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|