C14H10F3N3O2 — CID 108532495
N'-(3-methyl-2-pyridinyl)-N-(2,3,4-trifluorophenyl)oxamide (PubChem CID 108532495) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is N'-(3-methyl-2-pyridinyl)-N-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N'-(3-methyl-2-pyridinyl)-N-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 108532495 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N'-(3-methyl-2-pyridinyl)-N-(2,3,4-trifluorophenyl)oxamide |
| SMILES | Cc1cccnc1NC(=O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F3N3O2/c1-7-3-2-6-18-12(7)20-14(22)13(21)19-9-5-4-8(15)10(16)11(9)17/h2-6H,1H3,(H,19,21)(H,18,20,22) |
| InChIKey | KZPUPDJVSIACSZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|