About N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide
N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide (PubChem CID 108518697) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide |
| PubChem CID | 108518697 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide |
| SMILES | CCN(C(=O)C(=O)Nc1ncccc1C)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2/c1-3-19(13-9-5-4-6-10-13)16(21)15(20)18-14-12(2)8-7-11-17-14/h4-11H,3H2,1-2H3,(H,17,18,20) |
| InChIKey | KULSTHUWJQNSOV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide?
The IUPAC name of N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide (CID 108518697) is N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide.
What is the SMILES notation for N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide?
The canonical SMILES for N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide is CCN(C(=O)C(=O)Nc1ncccc1C)c1ccccc1.
What is the InChIKey of N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide?
The InChIKey is KULSTHUWJQNSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-3-19(13-9-5-4-6-10-13)16(21)15(20)18-14-12(2)8-7-11-17-14/h4-11H,3H2,1-2H3,(H,17,18,20).
What are the key properties of N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide?
N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide has a molecular weight of 283.33 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-(3-methyl-2-pyridinyl)-N'-phenyloxamide is sourced from PubChem (CID 108518697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).