C15H14BrN3O2 — CID 108532491
N-(2-bromo-4-methylphenyl)-N'-(3-methyl-2-pyridinyl)oxamide (PubChem CID 108532491) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-N'-(3-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-N'-(3-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108532491 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-N'-(3-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ncccc2C)c(Br)c1 |
| InChI | InChI=1S/C15H14BrN3O2/c1-9-5-6-12(11(16)8-9)18-14(20)15(21)19-13-10(2)4-3-7-17-13/h3-8H,1-2H3,(H,18,20)(H,17,19,21) |
| InChIKey | HOMIMDVOMUXSNE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|