C13H17BrN2O2 — CID 108506932
N-(2-bromo-4-methylphenyl)-N'-tert-butyloxamide (PubChem CID 108506932) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-N'-tert-butyloxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-N'-tert-butyloxamide |
|---|---|
| PubChem CID | 108506932 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-N'-tert-butyloxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-8-5-6-10(9(14)7-8)15-11(17)12(18)16-13(2,3)4/h5-7H,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | BLADPHGUBGSLBD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|