C14H13N3O3 — CID 44997063
N-(4-hydroxyphenyl)-N'-(3-methyl-2-pyridinyl)oxamide (PubChem CID 44997063) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-N'-(3-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(4-hydroxyphenyl)-N'-(3-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 44997063 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-N'-(3-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1cccnc1NC(=O)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C14H13N3O3/c1-9-3-2-8-15-12(9)17-14(20)13(19)16-10-4-6-11(18)7-5-10/h2-8,18H,1H3,(H,16,19)(H,15,17,20) |
| InChIKey | ATIPNEHGKPLBMX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|