C15H14N2O2 — CID 84553243
(E)-3-(4-hydroxyphenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide (PubChem CID 84553243) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxyphenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 84553243 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide |
| SMILES | Cc1cccnc1NC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14N2O2/c1-11-3-2-10-16-15(11)17-14(19)9-6-12-4-7-13(18)8-5-12/h2-10,18H,1H3,(H,16,17,19)/b9-6+ |
| InChIKey | WEUDXPQVXXLCFO-RMKNXTFCSA-N |
| XLogP | 2.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|