C15H13FN2O — CID 84554139
(E)-3-(3-fluorophenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide (PubChem CID 84554139) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 84554139 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-(3-methyl-2-pyridinyl)prop-2-enamide |
| SMILES | Cc1cccnc1NC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C15H13FN2O/c1-11-4-3-9-17-15(11)18-14(19)8-7-12-5-2-6-13(16)10-12/h2-10H,1H3,(H,17,18,19)/b8-7+ |
| InChIKey | MAEQXKNQJZKWFI-BQYQJAHWSA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|