C15H12FNO3S — CID 43356655
5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylic acid (PubChem CID 43356655) has the molecular formula C15H12FNO3S and a molecular weight of 305.33 g/mol. Its IUPAC name is 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43356655 |
| Molecular Formula | C15H12FNO3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)/C=C/c2cccc(F)c2)sc1C(=O)O |
| InChI | InChI=1S/C15H12FNO3S/c1-9-7-13(21-14(9)15(19)20)17-12(18)6-5-10-3-2-4-11(16)8-10/h2-8H,1H3,(H,17,18)(H,19,20)/b6-5+ |
| InChIKey | WUPAISITXKLYKJ-AATRIKPKSA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|