C16H14FNO3S — CID 8928510
methyl 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 8928510) has the molecular formula C16H14FNO3S and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 8928510 |
| Molecular Formula | C16H14FNO3S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methyl 5-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)/C=C/c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C16H14FNO3S/c1-10-8-14(22-15(10)16(20)21-2)18-13(19)7-6-11-4-3-5-12(17)9-11/h3-9H,1-2H3,(H,18,19)/b7-6+ |
| InChIKey | UESIBURTEXMVDD-VOTSOKGWSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|