C18H16FNO5 — CID 45427989
2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 45427989) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 45427989 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)/C=C/c2cccc(F)c2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C18H16FNO5/c1-24-15-9-13(18(22)23)14(10-16(15)25-2)20-17(21)7-6-11-4-3-5-12(19)8-11/h3-10H,1-2H3,(H,20,21)(H,22,23)/b7-6+ |
| InChIKey | YDIHKZQMPZTTJH-VOTSOKGWSA-N |
| XLogP | 3.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|