C19H18ClNO6 — CID 17296321
2-[[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 17296321) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-[[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 17296321 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1ccc(Cl)cc1/C=C/C(=O)Nc1cc(OC)c(OC)cc1C(=O)O |
| InChI | InChI=1S/C19H18ClNO6/c1-25-15-6-5-12(20)8-11(15)4-7-18(22)21-14-10-17(27-3)16(26-2)9-13(14)19(23)24/h4-10H,1-3H3,(H,21,22)(H,23,24)/b7-4+ |
| InChIKey | CJQUYACCKJNKOK-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|