C14H12ClN3O4 — CID 17342181
(E)-3-(5-chloro-2-methoxyphenyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide (PubChem CID 17342181) has the molecular formula C14H12ClN3O4 and a molecular weight of 321.72 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-methoxyphenyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17342181 |
| Molecular Formula | C14H12ClN3O4 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1/C=C/C(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H12ClN3O4/c1-22-11-4-3-9(15)6-8(11)2-5-12(19)17-10-7-16-14(21)18-13(10)20/h2-7H,1H3,(H,17,19)(H2,16,18,20,21)/b5-2+ |
| InChIKey | KIDRBSAJTYFLNG-GORDUTHDSA-N |
| XLogP | 1.38 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|