C27H28N2O5 — CID 32515361
4,5-dimethoxy-N,N-dimethyl-2-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 32515361) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 4,5-dimethoxy-N,N-dimethyl-2-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 4,5-dimethoxy-N,N-dimethyl-2-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 32515361 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4,5-dimethoxy-N,N-dimethyl-2-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1cc(NC(=O)/C=C/c2cccc(OCc3ccccc3)c2)c(C(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C27H28N2O5/c1-29(2)27(31)22-16-24(32-3)25(33-4)17-23(22)28-26(30)14-13-19-11-8-12-21(15-19)34-18-20-9-6-5-7-10-20/h5-17H,18H2,1-4H3,(H,28,30)/b14-13+ |
| InChIKey | IHARRIYIDMZZPG-BUHFOSPRSA-N |
| XLogP | 4.64 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|