C26H26N2O4 — CID 6234287
N-benzyl-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-methylbenzamide (PubChem CID 6234287) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-benzyl-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 6234287 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-benzyl-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-methylbenzamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)N(C)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H26N2O4/c1-28(18-20-9-5-4-6-10-20)26(30)21-11-7-8-12-22(21)27-25(29)16-14-19-13-15-23(31-2)24(17-19)32-3/h4-17H,18H2,1-3H3,(H,27,29)/b16-14+ |
| InChIKey | JTLUWYYXATYGDA-JQIJEIRASA-N |
| XLogP | 4.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|