C23H20FNO4 — CID 75910605
3-(3,4-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)phenyl]prop-2-enamide (PubChem CID 75910605) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75910605 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccccc2Oc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C23H20FNO4/c1-27-21-12-10-16(14-22(21)28-2)11-13-23(26)25-19-8-3-4-9-20(19)29-18-7-5-6-17(24)15-18/h3-15H,1-2H3,(H,25,26) |
| InChIKey | FPHSVEGWIPQMNH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|