C24H24N2O4 — CID 3469016
3-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyanilino)phenyl]prop-2-enamide (PubChem CID 3469016) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyanilino)phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyanilino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3469016 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyanilino)phenyl]prop-2-enamide |
| SMILES | COc1ccccc1Nc1ccc(NC(=O)C=Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-28-21-7-5-4-6-20(21)25-18-10-12-19(13-11-18)26-24(27)15-9-17-8-14-22(29-2)23(16-17)30-3/h4-16,25H,1-3H3,(H,26,27) |
| InChIKey | LAZYFQNNPAIWPC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|