C18H17NO4S — CID 129252363
[2-methoxy-4-[(E)-3-oxo-3-(4-sulfanylanilino)prop-1-enyl]phenyl] acetate (PubChem CID 129252363) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-oxo-3-(4-sulfanylanilino)prop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-oxo-3-(4-sulfanylanilino)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 129252363 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | [2-methoxy-4-[(E)-3-oxo-3-(4-sulfanylanilino)prop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(S)cc2)ccc1OC(C)=O |
| InChI | InChI=1S/C18H17NO4S/c1-12(20)23-16-9-3-13(11-17(16)22-2)4-10-18(21)19-14-5-7-15(24)8-6-14/h3-11,24H,1-2H3,(H,19,21)/b10-4+ |
| InChIKey | QMZFJCPFAUDDOF-ONNFQVAWSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|