C15H14N2O4S — CID 6217942
(E)-3-[4-[(3-methyl-2-pyridinyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 6217942) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is (E)-3-[4-[(3-methyl-2-pyridinyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-methyl-2-pyridinyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6217942 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (E)-3-[4-[(3-methyl-2-pyridinyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cccnc1NS(=O)(=O)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-11-3-2-10-16-15(11)17-22(20,21)13-7-4-12(5-8-13)6-9-14(18)19/h2-10H,1H3,(H,16,17)(H,18,19)/b9-6+ |
| InChIKey | JNTADSAFRNVCAA-RMKNXTFCSA-N |
| XLogP | 2.29 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|