C18H23N3S — CID 100731749
1-[(1R)-1-(3,4-dimethylphenyl)propyl]-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 100731749) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-dimethylphenyl)propyl]-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(1R)-1-(3,4-dimethylphenyl)propyl]-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100731749 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[(1R)-1-(3,4-dimethylphenyl)propyl]-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | CC[C@@H](NC(=S)Nc1ncccc1C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H23N3S/c1-5-16(15-9-8-12(2)14(4)11-15)20-18(22)21-17-13(3)7-6-10-19-17/h6-11,16H,5H2,1-4H3,(H2,19,20,21,22)/t16-/m1/s1 |
| InChIKey | MBFGKXIJLBNCQS-MRXNPFEDSA-N |
| XLogP | 4.44 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|