C13H12Cl2N4S — CID 19704090
1-[2-(2-chlorophenyl)ethyl]-3-(3-chloropyrazin-2-yl)thiourea (PubChem CID 19704090) has the molecular formula C13H12Cl2N4S and a molecular weight of 327.24 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-(3-chloropyrazin-2-yl)thiourea.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-(3-chloropyrazin-2-yl)thiourea |
|---|---|
| PubChem CID | 19704090 |
| Molecular Formula | C13H12Cl2N4S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-(3-chloropyrazin-2-yl)thiourea |
| SMILES | S=C(NCCc1ccccc1Cl)Nc1nccnc1Cl |
| InChI | InChI=1S/C13H12Cl2N4S/c14-10-4-2-1-3-9(10)5-6-18-13(20)19-12-11(15)16-7-8-17-12/h1-4,7-8H,5-6H2,(H2,17,18,19,20) |
| InChIKey | UGUDIJGJXOMWPD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|