C12H13N5S — CID 3002132
1-pyridazin-3-yl-3-(2-pyridin-2-ylethyl)thiourea (PubChem CID 3002132) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 1-pyridazin-3-yl-3-(2-pyridin-2-ylethyl)thiourea.
| Compound Name | 1-pyridazin-3-yl-3-(2-pyridin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 3002132 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-pyridazin-3-yl-3-(2-pyridin-2-ylethyl)thiourea |
| SMILES | S=C(NCCc1ccccn1)Nc1cccnn1 |
| InChI | InChI=1S/C12H13N5S/c18-12(16-11-5-3-8-15-17-11)14-9-6-10-4-1-2-7-13-10/h1-5,7-8H,6,9H2,(H2,14,16,17,18) |
| InChIKey | KQVSZZVSTLJYRR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|