C12H16N4S3 — CID 11859674
1-[(1R,4R)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]-3-(2-pyridin-2-ylethyl)thiourea (PubChem CID 11859674) has the molecular formula C12H16N4S3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 1-[(1R,4R)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]-3-(2-pyridin-2-ylethyl)thiourea.
| Compound Name | 1-[(1R,4R)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]-3-(2-pyridin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 11859674 |
| Molecular Formula | C12H16N4S3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[(1R,4R)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]-3-(2-pyridin-2-ylethyl)thiourea |
| SMILES | S=C(NCCc1ccccn1)NN1[C@H]2CS[C@@H]1CS2 |
| InChI | InChI=1S/C12H16N4S3/c17-12(14-6-4-9-3-1-2-5-13-9)15-16-10-7-18-11(16)8-19-10/h1-3,5,10-11H,4,6-8H2,(H2,14,15,17)/t10-,11-/m1/s1 |
| InChIKey | XPXDSENBLIPMNM-GHMZBOCLSA-N |
| XLogP | 1.45 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|