C13H19N5S — CID 57063003
1-[amino(pyrrolidin-1-yl)methylidene]-3-(2-pyridin-2-ylethyl)thiourea (PubChem CID 57063003) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 1-[amino(pyrrolidin-1-yl)methylidene]-3-(2-pyridin-2-ylethyl)thiourea.
| Compound Name | 1-[amino(pyrrolidin-1-yl)methylidene]-3-(2-pyridin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 57063003 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-[amino(pyrrolidin-1-yl)methylidene]-3-(2-pyridin-2-ylethyl)thiourea |
| SMILES | NC(=NC(=S)NCCc1ccccn1)N1CCCC1 |
| InChI | InChI=1S/C13H19N5S/c14-12(18-9-3-4-10-18)17-13(19)16-8-6-11-5-1-2-7-15-11/h1-2,5,7H,3-4,6,8-10H2,(H3,14,16,17,19) |
| InChIKey | LHDRRKAHOSWIEW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|