C15H24N6S — CID 57284394
1-[amino-(4-methylpiperazin-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea (PubChem CID 57284394) has the molecular formula C15H24N6S and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[amino-(4-methylpiperazin-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea.
| Compound Name | 1-[amino-(4-methylpiperazin-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea |
|---|---|
| PubChem CID | 57284394 |
| Molecular Formula | C15H24N6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[amino-(4-methylpiperazin-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea |
| SMILES | CN1CCN(C(N)=NC(=S)NCCCc2ccccn2)CC1 |
| InChI | InChI=1S/C15H24N6S/c1-20-9-11-21(12-10-20)14(16)19-15(22)18-8-4-6-13-5-2-3-7-17-13/h2-3,5,7H,4,6,8-12H2,1H3,(H3,16,18,19,22) |
| InChIKey | JKNYOCOGVOXXFV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|